C24H13N3O5S — CID 42065977
(1R)-2-(1,3-benzothiazol-2-yl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 42065977) has the molecular formula C24H13N3O5S and a molecular weight of 455.45 g/mol. Its IUPAC name is (1R)-2-(1,3-benzothiazol-2-yl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1R)-2-(1,3-benzothiazol-2-yl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 42065977 |
| Molecular Formula | C24H13N3O5S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | (1R)-2-(1,3-benzothiazol-2-yl)-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | O=C1c2oc3ccccc3c(=O)c2[C@@H](c2cccc([N+](=O)[O-])c2)N1c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H13N3O5S/c28-21-15-8-1-3-10-17(15)32-22-19(21)20(13-6-5-7-14(12-13)27(30)31)26(23(22)29)24-25-16-9-2-4-11-18(16)33-24/h1-12,20H/t20-/m1/s1 |
| InChIKey | FYNSJPUCSWZTHT-HXUWFJFHSA-N |
| XLogP | 5.06 |
| TPSA | 106.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|