C28H21N3O5S — CID 4696996
1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-hydroxy-2-(4-nitrophenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4696996) has the molecular formula C28H21N3O5S and a molecular weight of 511.56 g/mol. Its IUPAC name is 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-hydroxy-2-(4-nitrophenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-hydroxy-2-(4-nitrophenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4696996 |
| Molecular Formula | C28H21N3O5S |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-hydroxy-2-(4-nitrophenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | Cc1cc(C)c2nc(N3C(=O)C(O)=C(C(=O)C=Cc4ccccc4)C3c3ccc([N+](=O)[O-])cc3)sc2c1 |
| InChI | InChI=1S/C28H21N3O5S/c1-16-14-17(2)24-22(15-16)37-28(29-24)30-25(19-9-11-20(12-10-19)31(35)36)23(26(33)27(30)34)21(32)13-8-18-6-4-3-5-7-18/h3-15,25,33H,1-2H3 |
| InChIKey | SFABREGUDDNYAH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|