C33H30N2O5S — CID 6189781
1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(3-ethoxy-4-prop-2-enoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one (PubChem CID 6189781) has the molecular formula C33H30N2O5S and a molecular weight of 566.68 g/mol. Its IUPAC name is 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(3-ethoxy-4-prop-2-enoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one.
| Compound Name | 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(3-ethoxy-4-prop-2-enoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6189781 |
| Molecular Formula | C33H30N2O5S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(3-ethoxy-4-prop-2-enoxyphenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-5-one |
| SMILES | C=CCOc1ccc(C2C(C(=O)/C=C/c3ccccc3)=C(O)C(=O)N2c2nc3c(C)cc(C)cc3s2)cc1OCC |
| InChI | InChI=1S/C33H30N2O5S/c1-5-16-40-25-15-13-23(19-26(25)39-6-2)30-28(24(36)14-12-22-10-8-7-9-11-22)31(37)32(38)35(30)33-34-29-21(4)17-20(3)18-27(29)41-33/h5,7-15,17-19,30,37H,1,6,16H2,2-4H3/b14-12+ |
| InChIKey | XTOXLTSDYXWJQA-WYMLVPIESA-N |
| XLogP | 7.06 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|