C30H26N2O3S — CID 4697009
1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(4-ethylphenyl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4697009) has the molecular formula C30H26N2O3S and a molecular weight of 494.62 g/mol. Its IUPAC name is 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(4-ethylphenyl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(4-ethylphenyl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4697009 |
| Molecular Formula | C30H26N2O3S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(4-ethylphenyl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | CCc1ccc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2c2nc3c(C)cc(C)cc3s2)cc1 |
| InChI | InChI=1S/C30H26N2O3S/c1-4-20-10-13-22(14-11-20)27-25(23(33)15-12-21-8-6-5-7-9-21)28(34)29(35)32(27)30-31-26-19(3)16-18(2)17-24(26)36-30/h5-17,27,34H,4H2,1-3H3 |
| InChIKey | QAJKSWSRPZOPNT-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|