C24H17N3O6S — CID 6995103
(2S)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 6995103) has the molecular formula C24H17N3O6S and a molecular weight of 475.48 g/mol. Its IUPAC name is (2S)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | (2S)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6995103 |
| Molecular Formula | C24H17N3O6S |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | (2S)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | Cc1cc(C)c2nc(N3C(=O)C(O)=C(C(=O)c4ccco4)[C@@H]3c3ccc([N+](=O)[O-])cc3)sc2c1 |
| InChI | InChI=1S/C24H17N3O6S/c1-12-10-13(2)19-17(11-12)34-24(25-19)26-20(14-5-7-15(8-6-14)27(31)32)18(22(29)23(26)30)21(28)16-4-3-9-33-16/h3-11,20,29H,1-2H3/t20-/m0/s1 |
| InChIKey | IFOVDBTUQBZZSQ-FQEVSTJZSA-N |
| XLogP | 5.20 |
| TPSA | 126.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|