C34H26N2O5S — CID 4696856
1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxy-2-(3-phenoxyphenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4696856) has the molecular formula C34H26N2O5S and a molecular weight of 574.66 g/mol. Its IUPAC name is 1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxy-2-(3-phenoxyphenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxy-2-(3-phenoxyphenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4696856 |
| Molecular Formula | C34H26N2O5S |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-hydroxy-2-(3-phenoxyphenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | CCOc1ccc2nc(N3C(=O)C(O)=C(C(=O)C=Cc4ccccc4)C3c3cccc(Oc4ccccc4)c3)sc2c1 |
| InChI | InChI=1S/C34H26N2O5S/c1-2-40-25-17-18-27-29(21-25)42-34(35-27)36-31(23-12-9-15-26(20-23)41-24-13-7-4-8-14-24)30(32(38)33(36)39)28(37)19-16-22-10-5-3-6-11-22/h3-21,31,38H,2H2,1H3 |
| InChIKey | WDFUVNMVCBNHTC-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|