C32H33NO4 — CID 4697533
1-benzyl-2-(4-hexoxyphenyl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4697533) has the molecular formula C32H33NO4 and a molecular weight of 495.62 g/mol. Its IUPAC name is 1-benzyl-2-(4-hexoxyphenyl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 1-benzyl-2-(4-hexoxyphenyl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4697533 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 1-benzyl-2-(4-hexoxyphenyl)-4-hydroxy-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | CCCCCCOc1ccc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H33NO4/c1-2-3-4-11-22-37-27-19-17-26(18-20-27)30-29(28(34)21-16-24-12-7-5-8-13-24)31(35)32(36)33(30)23-25-14-9-6-10-15-25/h5-10,12-21,30,35H,2-4,11,22-23H2,1H3 |
| InChIKey | KUHITCFBDQUYHH-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|