C28H23NO5 — CID 6004699
methyl 4-[1-benzyl-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-2-yl]benzoate (PubChem CID 6004699) has the molecular formula C28H23NO5 and a molecular weight of 453.49 g/mol. Its IUPAC name is methyl 4-[1-benzyl-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-2-yl]benzoate.
| Compound Name | methyl 4-[1-benzyl-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 6004699 |
| Molecular Formula | C28H23NO5 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | methyl 4-[1-benzyl-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(C(=O)/C=C/c3ccccc3)=C(O)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H23NO5/c1-34-28(33)22-15-13-21(14-16-22)25-24(23(30)17-12-19-8-4-2-5-9-19)26(31)27(32)29(25)18-20-10-6-3-7-11-20/h2-17,25,31H,18H2,1H3/b17-12+ |
| InChIKey | IYGDXFHNGCZWEQ-SFQUDFHCSA-N |
| XLogP | 4.65 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|