C25H20N2O4 — CID 6190109
4-hydroxy-2-(4-hydroxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one (PubChem CID 6190109) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is 4-hydroxy-2-(4-hydroxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-2-(4-hydroxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6190109 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 4-hydroxy-2-(4-hydroxyphenyl)-3-[(E)-3-phenylprop-2-enoyl]-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one |
| SMILES | O=C(/C=C/c1ccccc1)C1=C(O)C(=O)N(Cc2cccnc2)C1c1ccc(O)cc1 |
| InChI | InChI=1S/C25H20N2O4/c28-20-11-9-19(10-12-20)23-22(21(29)13-8-17-5-2-1-3-6-17)24(30)25(31)27(23)16-18-7-4-14-26-15-18/h1-15,23,28,30H,16H2/b13-8+ |
| InChIKey | PDGCLUXXXIYZCZ-MDWZMJQESA-N |
| XLogP | 3.97 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|