C18H16N2O3 — CID 699369
(2S)-3-acetyl-4-hydroxy-2-phenyl-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one (PubChem CID 699369) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is (2S)-3-acetyl-4-hydroxy-2-phenyl-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one.
| Compound Name | (2S)-3-acetyl-4-hydroxy-2-phenyl-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 699369 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (2S)-3-acetyl-4-hydroxy-2-phenyl-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one |
| SMILES | CC(=O)C1=C(O)C(=O)N(Cc2cccnc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H16N2O3/c1-12(21)15-16(14-7-3-2-4-8-14)20(18(23)17(15)22)11-13-6-5-9-19-10-13/h2-10,16,22H,11H2,1H3/t16-/m0/s1 |
| InChIKey | VVRFSIBJHUNQLP-INIZCTEOSA-N |
| XLogP | 2.57 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |