C19H17FN2O3 — CID 108642910
2-(4-fluorophenyl)-4-hydroxy-3-propanoyl-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one (PubChem CID 108642910) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-hydroxy-3-propanoyl-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-fluorophenyl)-4-hydroxy-3-propanoyl-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108642910 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(4-fluorophenyl)-4-hydroxy-3-propanoyl-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one |
| SMILES | CCC(=O)C1=C(O)C(=O)N(Cc2cccnc2)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN2O3/c1-2-15(23)16-17(13-5-7-14(20)8-6-13)22(19(25)18(16)24)11-12-4-3-9-21-10-12/h3-10,17,24H,2,11H2,1H3 |
| InChIKey | WAOOWMLNLZPGCX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |