C22H24N2O4 — CID 108576626
4-hydroxy-2-(4-methoxyphenyl)-3-(3-methylbutanoyl)-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one (PubChem CID 108576626) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-hydroxy-2-(4-methoxyphenyl)-3-(3-methylbutanoyl)-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-2-(4-methoxyphenyl)-3-(3-methylbutanoyl)-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108576626 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-hydroxy-2-(4-methoxyphenyl)-3-(3-methylbutanoyl)-1-(pyridin-3-ylmethyl)-2H-pyrrol-5-one |
| SMILES | COc1ccc(C2C(C(=O)CC(C)C)=C(O)C(=O)N2Cc2cccnc2)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-14(2)11-18(25)19-20(16-6-8-17(28-3)9-7-16)24(22(27)21(19)26)13-15-5-4-10-23-12-15/h4-10,12,14,20,26H,11,13H2,1-3H3 |
| InChIKey | VUEYKUCXVHUSPY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |