C24H27FN2O3 — CID 108711310
2-[4-(diethylamino)phenyl]-1-[(4-fluorophenyl)methyl]-4-hydroxy-3-propanoyl-2H-pyrrol-5-one (PubChem CID 108711310) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is 2-[4-(diethylamino)phenyl]-1-[(4-fluorophenyl)methyl]-4-hydroxy-3-propanoyl-2H-pyrrol-5-one.
| Compound Name | 2-[4-(diethylamino)phenyl]-1-[(4-fluorophenyl)methyl]-4-hydroxy-3-propanoyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108711310 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-[4-(diethylamino)phenyl]-1-[(4-fluorophenyl)methyl]-4-hydroxy-3-propanoyl-2H-pyrrol-5-one |
| SMILES | CCC(=O)C1=C(O)C(=O)N(Cc2ccc(F)cc2)C1c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C24H27FN2O3/c1-4-20(28)21-22(17-9-13-19(14-10-17)26(5-2)6-3)27(24(30)23(21)29)15-16-7-11-18(25)12-8-16/h7-14,22,29H,4-6,15H2,1-3H3 |
| InChIKey | XUEXEBKTLHYASO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|