C23H25ClN2O3 — CID 108710788
1-(3-chlorophenyl)-2-[4-(diethylamino)phenyl]-4-hydroxy-3-propanoyl-2H-pyrrol-5-one (PubChem CID 108710788) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[4-(diethylamino)phenyl]-4-hydroxy-3-propanoyl-2H-pyrrol-5-one.
| Compound Name | 1-(3-chlorophenyl)-2-[4-(diethylamino)phenyl]-4-hydroxy-3-propanoyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108710788 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[4-(diethylamino)phenyl]-4-hydroxy-3-propanoyl-2H-pyrrol-5-one |
| SMILES | CCC(=O)C1=C(O)C(=O)N(c2cccc(Cl)c2)C1c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C23H25ClN2O3/c1-4-19(27)20-21(15-10-12-17(13-11-15)25(5-2)6-3)26(23(29)22(20)28)18-9-7-8-16(24)14-18/h7-14,21,28H,4-6H2,1-3H3 |
| InChIKey | IQISJCHQQQAJSE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |