C19H16ClNO4 — CID 108582601
1-(4-chlorophenyl)-4-hydroxy-2-(4-hydroxyphenyl)-3-propanoyl-2H-pyrrol-5-one (PubChem CID 108582601) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-hydroxy-2-(4-hydroxyphenyl)-3-propanoyl-2H-pyrrol-5-one.
| Compound Name | 1-(4-chlorophenyl)-4-hydroxy-2-(4-hydroxyphenyl)-3-propanoyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108582601 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 1-(4-chlorophenyl)-4-hydroxy-2-(4-hydroxyphenyl)-3-propanoyl-2H-pyrrol-5-one |
| SMILES | CCC(=O)C1=C(O)C(=O)N(c2ccc(Cl)cc2)C1c1ccc(O)cc1 |
| InChI | InChI=1S/C19H16ClNO4/c1-2-15(23)16-17(11-3-9-14(22)10-4-11)21(19(25)18(16)24)13-7-5-12(20)6-8-13/h3-10,17,22,24H,2H2,1H3 |
| InChIKey | NVUYQVAVXCGVLA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |