C22H22ClNO5 — CID 108704325
1-(3-chlorophenyl)-2-(3-ethoxy-4-methoxyphenyl)-4-hydroxy-3-propanoyl-2H-pyrrol-5-one (PubChem CID 108704325) has the molecular formula C22H22ClNO5 and a molecular weight of 415.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(3-ethoxy-4-methoxyphenyl)-4-hydroxy-3-propanoyl-2H-pyrrol-5-one.
| Compound Name | 1-(3-chlorophenyl)-2-(3-ethoxy-4-methoxyphenyl)-4-hydroxy-3-propanoyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108704325 |
| Molecular Formula | C22H22ClNO5 |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(3-ethoxy-4-methoxyphenyl)-4-hydroxy-3-propanoyl-2H-pyrrol-5-one |
| SMILES | CCOc1cc(C2C(C(=O)CC)=C(O)C(=O)N2c2cccc(Cl)c2)ccc1OC |
| InChI | InChI=1S/C22H22ClNO5/c1-4-16(25)19-20(13-9-10-17(28-3)18(11-13)29-5-2)24(22(27)21(19)26)15-8-6-7-14(23)12-15/h6-12,20,26H,4-5H2,1-3H3 |
| InChIKey | BFCZIQJRNXOJOY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |