C26H32N2O3 — CID 108669944
1-[4-(diethylamino)phenyl]-4-hydroxy-3-(3-methylbutanoyl)-2-(3-methylphenyl)-2H-pyrrol-5-one (PubChem CID 108669944) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-4-hydroxy-3-(3-methylbutanoyl)-2-(3-methylphenyl)-2H-pyrrol-5-one.
| Compound Name | 1-[4-(diethylamino)phenyl]-4-hydroxy-3-(3-methylbutanoyl)-2-(3-methylphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108669944 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-4-hydroxy-3-(3-methylbutanoyl)-2-(3-methylphenyl)-2H-pyrrol-5-one |
| SMILES | CCN(CC)c1ccc(N2C(=O)C(O)=C(C(=O)CC(C)C)C2c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C26H32N2O3/c1-6-27(7-2)20-11-13-21(14-12-20)28-24(19-10-8-9-18(5)16-19)23(25(30)26(28)31)22(29)15-17(3)4/h8-14,16-17,24,30H,6-7,15H2,1-5H3 |
| InChIKey | MRVDBEUQNCZXCL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|