C28H36N2O3 — CID 108711400
2-[4-(diethylamino)phenyl]-1-[(2,5-dimethylphenyl)methyl]-4-hydroxy-3-(3-methylbutanoyl)-2H-pyrrol-5-one (PubChem CID 108711400) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is 2-[4-(diethylamino)phenyl]-1-[(2,5-dimethylphenyl)methyl]-4-hydroxy-3-(3-methylbutanoyl)-2H-pyrrol-5-one.
| Compound Name | 2-[4-(diethylamino)phenyl]-1-[(2,5-dimethylphenyl)methyl]-4-hydroxy-3-(3-methylbutanoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108711400 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 2-[4-(diethylamino)phenyl]-1-[(2,5-dimethylphenyl)methyl]-4-hydroxy-3-(3-methylbutanoyl)-2H-pyrrol-5-one |
| SMILES | CCN(CC)c1ccc(C2C(C(=O)CC(C)C)=C(O)C(=O)N2Cc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C28H36N2O3/c1-7-29(8-2)23-13-11-21(12-14-23)26-25(24(31)15-18(3)4)27(32)28(33)30(26)17-22-16-19(5)9-10-20(22)6/h9-14,16,18,26,32H,7-8,15,17H2,1-6H3 |
| InChIKey | QWHSEBRZVRHUTB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|