C25H30N2O4 — CID 108681489
1-[4-(diethylamino)phenyl]-4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-2H-pyrrol-5-one (PubChem CID 108681489) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-2H-pyrrol-5-one.
| Compound Name | 1-[4-(diethylamino)phenyl]-4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108681489 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-2H-pyrrol-5-one |
| SMILES | CCN(CC)c1ccc(N2C(=O)C(O)=C(C(=O)CC(C)C)C2c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C25H30N2O4/c1-5-26(6-2)18-10-12-19(13-11-18)27-23(17-8-7-9-20(28)15-17)22(24(30)25(27)31)21(29)14-16(3)4/h7-13,15-16,23,28,30H,5-6,14H2,1-4H3 |
| InChIKey | VSADEFDSWKZWTF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|