C20H27NO4 — CID 108648628
4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-1-pentyl-2H-pyrrol-5-one (PubChem CID 108648628) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-1-pentyl-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-1-pentyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108648628 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-1-pentyl-2H-pyrrol-5-one |
| SMILES | CCCCCN1C(=O)C(O)=C(C(=O)CC(C)C)C1c1cccc(O)c1 |
| InChI | InChI=1S/C20H27NO4/c1-4-5-6-10-21-18(14-8-7-9-15(22)12-14)17(19(24)20(21)25)16(23)11-13(2)3/h7-9,12-13,18,22,24H,4-6,10-11H2,1-3H3 |
| InChIKey | JPBCWFOAMVIFMM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|