C20H26FNO3 — CID 108646006
2-(2-fluorophenyl)-4-hydroxy-3-(3-methylbutanoyl)-1-pentyl-2H-pyrrol-5-one (PubChem CID 108646006) has the molecular formula C20H26FNO3 and a molecular weight of 347.43 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-4-hydroxy-3-(3-methylbutanoyl)-1-pentyl-2H-pyrrol-5-one.
| Compound Name | 2-(2-fluorophenyl)-4-hydroxy-3-(3-methylbutanoyl)-1-pentyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108646006 |
| Molecular Formula | C20H26FNO3 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-(2-fluorophenyl)-4-hydroxy-3-(3-methylbutanoyl)-1-pentyl-2H-pyrrol-5-one |
| SMILES | CCCCCN1C(=O)C(O)=C(C(=O)CC(C)C)C1c1ccccc1F |
| InChI | InChI=1S/C20H26FNO3/c1-4-5-8-11-22-18(14-9-6-7-10-15(14)21)17(19(24)20(22)25)16(23)12-13(2)3/h6-7,9-10,13,18,24H,4-5,8,11-12H2,1-3H3 |
| InChIKey | DLGWGYYNTOKVTE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|