C19H24FNO4 — CID 108603173
2-(2-fluorophenyl)-4-hydroxy-3-propanoyl-1-(3-propan-2-yloxypropyl)-2H-pyrrol-5-one (PubChem CID 108603173) has the molecular formula C19H24FNO4 and a molecular weight of 349.40 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-4-hydroxy-3-propanoyl-1-(3-propan-2-yloxypropyl)-2H-pyrrol-5-one.
| Compound Name | 2-(2-fluorophenyl)-4-hydroxy-3-propanoyl-1-(3-propan-2-yloxypropyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108603173 |
| Molecular Formula | C19H24FNO4 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2-(2-fluorophenyl)-4-hydroxy-3-propanoyl-1-(3-propan-2-yloxypropyl)-2H-pyrrol-5-one |
| SMILES | CCC(=O)C1=C(O)C(=O)N(CCCOC(C)C)C1c1ccccc1F |
| InChI | InChI=1S/C19H24FNO4/c1-4-15(22)16-17(13-8-5-6-9-14(13)20)21(19(24)18(16)23)10-7-11-25-12(2)3/h5-6,8-9,12,17,23H,4,7,10-11H2,1-3H3 |
| InChIKey | NIYZKSSWACGGRJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|