C20H27NO4 — CID 108652478
4-hydroxy-2-(2-methylphenyl)-3-propanoyl-1-(3-propan-2-yloxypropyl)-2H-pyrrol-5-one (PubChem CID 108652478) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 4-hydroxy-2-(2-methylphenyl)-3-propanoyl-1-(3-propan-2-yloxypropyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-2-(2-methylphenyl)-3-propanoyl-1-(3-propan-2-yloxypropyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108652478 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 4-hydroxy-2-(2-methylphenyl)-3-propanoyl-1-(3-propan-2-yloxypropyl)-2H-pyrrol-5-one |
| SMILES | CCC(=O)C1=C(O)C(=O)N(CCCOC(C)C)C1c1ccccc1C |
| InChI | InChI=1S/C20H27NO4/c1-5-16(22)17-18(15-10-7-6-9-14(15)4)21(20(24)19(17)23)11-8-12-25-13(2)3/h6-7,9-10,13,18,23H,5,8,11-12H2,1-4H3 |
| InChIKey | FBZDIYWNALTFEL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|