C22H31NO7 — CID 108702788
4-hydroxy-3-propanoyl-1-(3-propan-2-yloxypropyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one (PubChem CID 108702788) has the molecular formula C22H31NO7 and a molecular weight of 421.49 g/mol. Its IUPAC name is 4-hydroxy-3-propanoyl-1-(3-propan-2-yloxypropyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-3-propanoyl-1-(3-propan-2-yloxypropyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108702788 |
| Molecular Formula | C22H31NO7 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 4-hydroxy-3-propanoyl-1-(3-propan-2-yloxypropyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one |
| SMILES | CCC(=O)C1=C(O)C(=O)N(CCCOC(C)C)C1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H31NO7/c1-7-15(24)18-19(14-11-16(27-4)21(29-6)17(12-14)28-5)23(22(26)20(18)25)9-8-10-30-13(2)3/h11-13,19,25H,7-10H2,1-6H3 |
| InChIKey | HLKLSIQGSANERZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|