C28H35NO7 — CID 108702805
4-hydroxy-3-(3-phenylpropanoyl)-1-(3-propan-2-yloxypropyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one (PubChem CID 108702805) has the molecular formula C28H35NO7 and a molecular weight of 497.59 g/mol. Its IUPAC name is 4-hydroxy-3-(3-phenylpropanoyl)-1-(3-propan-2-yloxypropyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-3-(3-phenylpropanoyl)-1-(3-propan-2-yloxypropyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108702805 |
| Molecular Formula | C28H35NO7 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 4-hydroxy-3-(3-phenylpropanoyl)-1-(3-propan-2-yloxypropyl)-2-(3,4,5-trimethoxyphenyl)-2H-pyrrol-5-one |
| SMILES | COc1cc(C2C(C(=O)CCc3ccccc3)=C(O)C(=O)N2CCCOC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C28H35NO7/c1-18(2)36-15-9-14-29-25(20-16-22(33-3)27(35-5)23(17-20)34-4)24(26(31)28(29)32)21(30)13-12-19-10-7-6-8-11-19/h6-8,10-11,16-18,25,31H,9,12-15H2,1-5H3 |
| InChIKey | OKIIXARXGHRBMS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|