C25H29NO7 — CID 3485641
2-(3,4-dimethoxyphenyl)-4-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]-3-(3-phenylpropanoyl)-2H-pyrrol-5-one (PubChem CID 3485641) has the molecular formula C25H29NO7 and a molecular weight of 455.51 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]-3-(3-phenylpropanoyl)-2H-pyrrol-5-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]-3-(3-phenylpropanoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3485641 |
| Molecular Formula | C25H29NO7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]-3-(3-phenylpropanoyl)-2H-pyrrol-5-one |
| SMILES | COc1ccc(C2C(C(=O)CCc3ccccc3)=C(O)C(=O)N2CCOCCO)cc1OC |
| InChI | InChI=1S/C25H29NO7/c1-31-20-11-9-18(16-21(20)32-2)23-22(19(28)10-8-17-6-4-3-5-7-17)24(29)25(30)26(23)12-14-33-15-13-27/h3-7,9,11,16,23,27,29H,8,10,12-15H2,1-2H3 |
| InChIKey | OAWNRLPFWFTYPO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|