C25H29NO5 — CID 108620563
1-butyl-2-(3-ethoxy-4-hydroxyphenyl)-4-hydroxy-3-(3-phenylpropanoyl)-2H-pyrrol-5-one (PubChem CID 108620563) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is 1-butyl-2-(3-ethoxy-4-hydroxyphenyl)-4-hydroxy-3-(3-phenylpropanoyl)-2H-pyrrol-5-one.
| Compound Name | 1-butyl-2-(3-ethoxy-4-hydroxyphenyl)-4-hydroxy-3-(3-phenylpropanoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108620563 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-butyl-2-(3-ethoxy-4-hydroxyphenyl)-4-hydroxy-3-(3-phenylpropanoyl)-2H-pyrrol-5-one |
| SMILES | CCCCN1C(=O)C(O)=C(C(=O)CCc2ccccc2)C1c1ccc(O)c(OCC)c1 |
| InChI | InChI=1S/C25H29NO5/c1-3-5-15-26-23(18-12-14-19(27)21(16-18)31-4-2)22(24(29)25(26)30)20(28)13-11-17-9-7-6-8-10-17/h6-10,12,14,16,23,27,29H,3-5,11,13,15H2,1-2H3 |
| InChIKey | QNRPQDGDTYPCFS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |