C25H27NO4 — CID 108664760
4-hydroxy-3-(3-phenylpropanoyl)-2-(3-prop-2-enoxyphenyl)-1-propyl-2H-pyrrol-5-one (PubChem CID 108664760) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is 4-hydroxy-3-(3-phenylpropanoyl)-2-(3-prop-2-enoxyphenyl)-1-propyl-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-3-(3-phenylpropanoyl)-2-(3-prop-2-enoxyphenyl)-1-propyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108664760 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 4-hydroxy-3-(3-phenylpropanoyl)-2-(3-prop-2-enoxyphenyl)-1-propyl-2H-pyrrol-5-one |
| SMILES | C=CCOc1cccc(C2C(C(=O)CCc3ccccc3)=C(O)C(=O)N2CCC)c1 |
| InChI | InChI=1S/C25H27NO4/c1-3-15-26-23(19-11-8-12-20(17-19)30-16-4-2)22(24(28)25(26)29)21(27)14-13-18-9-6-5-7-10-18/h4-12,17,23,28H,2-3,13-16H2,1H3 |
| InChIKey | BALACTGKAUYODC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|