C25H23NO5 — CID 108664719
3-(1-benzofuran-2-carbonyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-1-propyl-2H-pyrrol-5-one (PubChem CID 108664719) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-1-propyl-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-1-propyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108664719 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-4-hydroxy-2-(3-prop-2-enoxyphenyl)-1-propyl-2H-pyrrol-5-one |
| SMILES | C=CCOc1cccc(C2C(C(=O)c3cc4ccccc4o3)=C(O)C(=O)N2CCC)c1 |
| InChI | InChI=1S/C25H23NO5/c1-3-12-26-22(17-9-7-10-18(14-17)30-13-4-2)21(24(28)25(26)29)23(27)20-15-16-8-5-6-11-19(16)31-20/h4-11,14-15,22,28H,2-3,12-13H2,1H3 |
| InChIKey | NOPINNBPPKODHC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|