C24H23NO5 — CID 108648601
3-(1-benzofuran-2-carbonyl)-4-hydroxy-2-(3-hydroxyphenyl)-1-pentyl-2H-pyrrol-5-one (PubChem CID 108648601) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-4-hydroxy-2-(3-hydroxyphenyl)-1-pentyl-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-4-hydroxy-2-(3-hydroxyphenyl)-1-pentyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108648601 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-4-hydroxy-2-(3-hydroxyphenyl)-1-pentyl-2H-pyrrol-5-one |
| SMILES | CCCCCN1C(=O)C(O)=C(C(=O)c2cc3ccccc3o2)C1c1cccc(O)c1 |
| InChI | InChI=1S/C24H23NO5/c1-2-3-6-12-25-21(16-9-7-10-17(26)13-16)20(23(28)24(25)29)22(27)19-14-15-8-4-5-11-18(15)30-19/h4-5,7-11,13-14,21,26,28H,2-3,6,12H2,1H3 |
| InChIKey | DZBWHFGVMFDOBR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|