C22H21NO4S — CID 108624378
3-(1-benzofuran-2-carbonyl)-4-hydroxy-1-pentyl-2-thiophen-2-yl-2H-pyrrol-5-one (PubChem CID 108624378) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-4-hydroxy-1-pentyl-2-thiophen-2-yl-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-4-hydroxy-1-pentyl-2-thiophen-2-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108624378 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-4-hydroxy-1-pentyl-2-thiophen-2-yl-2H-pyrrol-5-one |
| SMILES | CCCCCN1C(=O)C(O)=C(C(=O)c2cc3ccccc3o2)C1c1cccs1 |
| InChI | InChI=1S/C22H21NO4S/c1-2-3-6-11-23-19(17-10-7-12-28-17)18(21(25)22(23)26)20(24)16-13-14-8-4-5-9-15(14)27-16/h4-5,7-10,12-13,19,25H,2-3,6,11H2,1H3 |
| InChIKey | TVGPKUDRBOWSIS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|