C23H22ClNO5S — CID 108624422
3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-pentyl-2-thiophen-2-yl-2H-pyrrol-5-one (PubChem CID 108624422) has the molecular formula C23H22ClNO5S and a molecular weight of 459.95 g/mol. Its IUPAC name is 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-pentyl-2-thiophen-2-yl-2H-pyrrol-5-one.
| Compound Name | 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-pentyl-2-thiophen-2-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108624422 |
| Molecular Formula | C23H22ClNO5S |
| Molecular Weight | 459.95 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-pentyl-2-thiophen-2-yl-2H-pyrrol-5-one |
| SMILES | CCCCCN1C(=O)C(O)=C(C(=O)c2cc3cc(Cl)cc(OC)c3o2)C1c1cccs1 |
| InChI | InChI=1S/C23H22ClNO5S/c1-3-4-5-8-25-19(17-7-6-9-31-17)18(21(27)23(25)28)20(26)15-11-13-10-14(24)12-16(29-2)22(13)30-15/h6-7,9-12,19,27H,3-5,8H2,1-2H3 |
| InChIKey | AIGXPSNTSGHXCB-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.95 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|