C20H17NO4S — CID 108624291
3-(1-benzofuran-2-carbonyl)-4-hydroxy-1-propyl-2-thiophen-2-yl-2H-pyrrol-5-one (PubChem CID 108624291) has the molecular formula C20H17NO4S and a molecular weight of 367.43 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-4-hydroxy-1-propyl-2-thiophen-2-yl-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-4-hydroxy-1-propyl-2-thiophen-2-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108624291 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-4-hydroxy-1-propyl-2-thiophen-2-yl-2H-pyrrol-5-one |
| SMILES | CCCN1C(=O)C(O)=C(C(=O)c2cc3ccccc3o2)C1c1cccs1 |
| InChI | InChI=1S/C20H17NO4S/c1-2-9-21-17(15-8-5-10-26-15)16(19(23)20(21)24)18(22)14-11-12-6-3-4-7-13(12)25-14/h3-8,10-11,17,23H,2,9H2,1H3 |
| InChIKey | QRASUOLELVHBEW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |