C26H27NO4 — CID 108620847
3-(1-benzofuran-2-carbonyl)-2-(4-tert-butylphenyl)-4-hydroxy-1-propyl-2H-pyrrol-5-one (PubChem CID 108620847) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-2-(4-tert-butylphenyl)-4-hydroxy-1-propyl-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-2-(4-tert-butylphenyl)-4-hydroxy-1-propyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108620847 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-2-(4-tert-butylphenyl)-4-hydroxy-1-propyl-2H-pyrrol-5-one |
| SMILES | CCCN1C(=O)C(O)=C(C(=O)c2cc3ccccc3o2)C1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H27NO4/c1-5-14-27-22(16-10-12-18(13-11-16)26(2,3)4)21(24(29)25(27)30)23(28)20-15-17-8-6-7-9-19(17)31-20/h6-13,15,22,29H,5,14H2,1-4H3 |
| InChIKey | NJCPGQHVBVETSO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |