C24H23NO5 — CID 5156084
3-(1-benzofuran-2-carbonyl)-2-(4-ethylphenyl)-4-hydroxy-1-(2-methoxyethyl)-2H-pyrrol-5-one (PubChem CID 5156084) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-2-(4-ethylphenyl)-4-hydroxy-1-(2-methoxyethyl)-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-2-(4-ethylphenyl)-4-hydroxy-1-(2-methoxyethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 5156084 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-2-(4-ethylphenyl)-4-hydroxy-1-(2-methoxyethyl)-2H-pyrrol-5-one |
| SMILES | CCc1ccc(C2C(C(=O)c3cc4ccccc4o3)=C(O)C(=O)N2CCOC)cc1 |
| InChI | InChI=1S/C24H23NO5/c1-3-15-8-10-16(11-9-15)21-20(23(27)24(28)25(21)12-13-29-2)22(26)19-14-17-6-4-5-7-18(17)30-19/h4-11,14,21,27H,3,12-13H2,1-2H3 |
| InChIKey | AVRVUYUUNGIDFO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |