C29H26N2O5 — CID 108681462
3-(1-benzofuran-2-carbonyl)-1-[4-(diethylamino)phenyl]-4-hydroxy-2-(3-hydroxyphenyl)-2H-pyrrol-5-one (PubChem CID 108681462) has the molecular formula C29H26N2O5 and a molecular weight of 482.54 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-1-[4-(diethylamino)phenyl]-4-hydroxy-2-(3-hydroxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-1-[4-(diethylamino)phenyl]-4-hydroxy-2-(3-hydroxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108681462 |
| Molecular Formula | C29H26N2O5 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-1-[4-(diethylamino)phenyl]-4-hydroxy-2-(3-hydroxyphenyl)-2H-pyrrol-5-one |
| SMILES | CCN(CC)c1ccc(N2C(=O)C(O)=C(C(=O)c3cc4ccccc4o3)C2c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C29H26N2O5/c1-3-30(4-2)20-12-14-21(15-13-20)31-26(19-9-7-10-22(32)16-19)25(28(34)29(31)35)27(33)24-17-18-8-5-6-11-23(18)36-24/h5-17,26,32,34H,3-4H2,1-2H3 |
| InChIKey | BRRNAPIEWQPPKJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|