C30H28N2O5 — CID 108697204
3-(1-benzofuran-2-carbonyl)-1-[4-(diethylamino)phenyl]-4-hydroxy-2-(4-methoxyphenyl)-2H-pyrrol-5-one (PubChem CID 108697204) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-1-[4-(diethylamino)phenyl]-4-hydroxy-2-(4-methoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-1-[4-(diethylamino)phenyl]-4-hydroxy-2-(4-methoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108697204 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-1-[4-(diethylamino)phenyl]-4-hydroxy-2-(4-methoxyphenyl)-2H-pyrrol-5-one |
| SMILES | CCN(CC)c1ccc(N2C(=O)C(O)=C(C(=O)c3cc4ccccc4o3)C2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H28N2O5/c1-4-31(5-2)21-12-14-22(15-13-21)32-27(19-10-16-23(36-3)17-11-19)26(29(34)30(32)35)28(33)25-18-20-8-6-7-9-24(20)37-25/h6-18,27,34H,4-5H2,1-3H3 |
| InChIKey | KUNAEUBGFFIICE-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|