C26H32N2O4 — CID 108697226
1-[4-(diethylamino)phenyl]-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-methoxyphenyl)-2H-pyrrol-5-one (PubChem CID 108697226) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-methoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 1-[4-(diethylamino)phenyl]-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-methoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108697226 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-methoxyphenyl)-2H-pyrrol-5-one |
| SMILES | CCN(CC)c1ccc(N2C(=O)C(O)=C(C(=O)C(C)(C)C)C2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H32N2O4/c1-7-27(8-2)18-11-13-19(14-12-18)28-22(17-9-15-20(32-6)16-10-17)21(23(29)25(28)31)24(30)26(3,4)5/h9-16,22,29H,7-8H2,1-6H3 |
| InChIKey | CLBIJEOQBUGQTB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|