C22H25NO4S — CID 108622009
4-hydroxy-3-(3-phenylpropanoyl)-1-(2-propan-2-yloxyethyl)-2-thiophen-2-yl-2H-pyrrol-5-one (PubChem CID 108622009) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is 4-hydroxy-3-(3-phenylpropanoyl)-1-(2-propan-2-yloxyethyl)-2-thiophen-2-yl-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-3-(3-phenylpropanoyl)-1-(2-propan-2-yloxyethyl)-2-thiophen-2-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108622009 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-hydroxy-3-(3-phenylpropanoyl)-1-(2-propan-2-yloxyethyl)-2-thiophen-2-yl-2H-pyrrol-5-one |
| SMILES | CC(C)OCCN1C(=O)C(O)=C(C(=O)CCc2ccccc2)C1c1cccs1 |
| InChI | InChI=1S/C22H25NO4S/c1-15(2)27-13-12-23-20(18-9-6-14-28-18)19(21(25)22(23)26)17(24)11-10-16-7-4-3-5-8-16/h3-9,14-15,20,25H,10-13H2,1-2H3 |
| InChIKey | UUWDRAVGRBOOMF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |