C20H17F2NO3 — CID 108603260
2-(2-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4-hydroxy-3-propanoyl-2H-pyrrol-5-one (PubChem CID 108603260) has the molecular formula C20H17F2NO3 and a molecular weight of 357.36 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4-hydroxy-3-propanoyl-2H-pyrrol-5-one.
| Compound Name | 2-(2-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4-hydroxy-3-propanoyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108603260 |
| Molecular Formula | C20H17F2NO3 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-(2-fluorophenyl)-1-[(4-fluorophenyl)methyl]-4-hydroxy-3-propanoyl-2H-pyrrol-5-one |
| SMILES | CCC(=O)C1=C(O)C(=O)N(Cc2ccc(F)cc2)C1c1ccccc1F |
| InChI | InChI=1S/C20H17F2NO3/c1-2-16(24)17-18(14-5-3-4-6-15(14)22)23(20(26)19(17)25)11-12-7-9-13(21)10-8-12/h3-10,18,25H,2,11H2,1H3 |
| InChIKey | NUEHFZMFAYIACI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |