C16H16FNO5 — CID 3265466
4-[3-acetyl-2-(2-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]butanoic acid (PubChem CID 3265466) has the molecular formula C16H16FNO5 and a molecular weight of 321.30 g/mol. Its IUPAC name is 4-[3-acetyl-2-(2-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]butanoic acid.
| Compound Name | 4-[3-acetyl-2-(2-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 3265466 |
| Molecular Formula | C16H16FNO5 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-[3-acetyl-2-(2-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]butanoic acid |
| SMILES | CC(=O)C1=C(O)C(=O)N(CCCC(=O)O)C1c1ccccc1F |
| InChI | InChI=1S/C16H16FNO5/c1-9(19)13-14(10-5-2-3-6-11(10)17)18(16(23)15(13)22)8-4-7-12(20)21/h2-3,5-6,14,22H,4,7-8H2,1H3,(H,20,21) |
| InChIKey | AZPIWEOWYVXJLM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |