C14H11FNO5- — CID 6943623
2-[(2R)-3-acetyl-2-(2-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]acetate (PubChem CID 6943623) has the molecular formula C14H11FNO5- and a molecular weight of 292.24 g/mol. Its IUPAC name is 2-[(2R)-3-acetyl-2-(2-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]acetate.
| Compound Name | 2-[(2R)-3-acetyl-2-(2-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]acetate |
|---|---|
| PubChem CID | 6943623 |
| Molecular Formula | C14H11FNO5- |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-[(2R)-3-acetyl-2-(2-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]acetate |
| SMILES | CC(=O)C1=C(O)C(=O)N(CC(=O)[O-])[C@H]1c1ccccc1F |
| InChI | InChI=1S/C14H12FNO5/c1-7(17)11-12(8-4-2-3-5-9(8)15)16(6-10(18)19)14(21)13(11)20/h2-5,12,20H,6H2,1H3,(H,18,19)/p-1/t12-/m0/s1 |
| InChIKey | VEPGUGQACYDATA-LBPRGKRZSA-M |
| XLogP | -0.14 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |