C15H14NO5- — CID 6922872
3-[(2R)-3-acetyl-4-hydroxy-5-oxo-2-phenyl-2H-pyrrol-1-yl]propanoate (PubChem CID 6922872) has the molecular formula C15H14NO5- and a molecular weight of 288.28 g/mol. Its IUPAC name is 3-[(2R)-3-acetyl-4-hydroxy-5-oxo-2-phenyl-2H-pyrrol-1-yl]propanoate.
| Compound Name | 3-[(2R)-3-acetyl-4-hydroxy-5-oxo-2-phenyl-2H-pyrrol-1-yl]propanoate |
|---|---|
| PubChem CID | 6922872 |
| Molecular Formula | C15H14NO5- |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-[(2R)-3-acetyl-4-hydroxy-5-oxo-2-phenyl-2H-pyrrol-1-yl]propanoate |
| SMILES | CC(=O)C1=C(O)C(=O)N(CCC(=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H15NO5/c1-9(17)12-13(10-5-3-2-4-6-10)16(8-7-11(18)19)15(21)14(12)20/h2-6,13,20H,7-8H2,1H3,(H,18,19)/p-1/t13-/m1/s1 |
| InChIKey | XFMRNIFNQMSMDQ-CYBMUJFWSA-M |
| XLogP | 0.11 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |