C15H13FNO5- — CID 6937652
3-[(2S)-3-acetyl-2-(4-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]propanoate (PubChem CID 6937652) has the molecular formula C15H13FNO5- and a molecular weight of 306.27 g/mol. Its IUPAC name is 3-[(2S)-3-acetyl-2-(4-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]propanoate.
| Compound Name | 3-[(2S)-3-acetyl-2-(4-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]propanoate |
|---|---|
| PubChem CID | 6937652 |
| Molecular Formula | C15H13FNO5- |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3-[(2S)-3-acetyl-2-(4-fluorophenyl)-4-hydroxy-5-oxo-2H-pyrrol-1-yl]propanoate |
| SMILES | CC(=O)C1=C(O)C(=O)N(CCC(=O)[O-])[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H14FNO5/c1-8(18)12-13(9-2-4-10(16)5-3-9)17(7-6-11(19)20)15(22)14(12)21/h2-5,13,21H,6-7H2,1H3,(H,19,20)/p-1/t13-/m0/s1 |
| InChIKey | YGZFRFFCIKGRID-ZDUSSCGKSA-M |
| XLogP | 0.25 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |