C23H19FNO5- — CID 7430649
4-[(2R)-2-(4-fluorophenyl)-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]butanoate (PubChem CID 7430649) has the molecular formula C23H19FNO5- and a molecular weight of 408.41 g/mol. Its IUPAC name is 4-[(2R)-2-(4-fluorophenyl)-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]butanoate.
| Compound Name | 4-[(2R)-2-(4-fluorophenyl)-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]butanoate |
|---|---|
| PubChem CID | 7430649 |
| Molecular Formula | C23H19FNO5- |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 4-[(2R)-2-(4-fluorophenyl)-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]butanoate |
| SMILES | O=C([O-])CCCN1C(=O)C(O)=C(C(=O)/C=C/c2ccccc2)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H20FNO5/c24-17-11-9-16(10-12-17)21-20(18(26)13-8-15-5-2-1-3-6-15)22(29)23(30)25(21)14-4-7-19(27)28/h1-3,5-6,8-13,21,29H,4,7,14H2,(H,27,28)/p-1/b13-8+/t21-/m1/s1 |
| InChIKey | WAHDVZAPRVNXQO-CDDKBXLESA-M |
| XLogP | 2.33 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|