C24H22NO6- — CID 7430641
4-[(2R)-4-hydroxy-2-(2-methoxyphenyl)-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]butanoate (PubChem CID 7430641) has the molecular formula C24H22NO6- and a molecular weight of 420.44 g/mol. Its IUPAC name is 4-[(2R)-4-hydroxy-2-(2-methoxyphenyl)-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]butanoate.
| Compound Name | 4-[(2R)-4-hydroxy-2-(2-methoxyphenyl)-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]butanoate |
|---|---|
| PubChem CID | 7430641 |
| Molecular Formula | C24H22NO6- |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 4-[(2R)-4-hydroxy-2-(2-methoxyphenyl)-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]butanoate |
| SMILES | COc1ccccc1[C@@H]1C(C(=O)/C=C/c2ccccc2)=C(O)C(=O)N1CCCC(=O)[O-] |
| InChI | InChI=1S/C24H23NO6/c1-31-19-11-6-5-10-17(19)22-21(18(26)14-13-16-8-3-2-4-9-16)23(29)24(30)25(22)15-7-12-20(27)28/h2-6,8-11,13-14,22,29H,7,12,15H2,1H3,(H,27,28)/p-1/b14-13+/t22-/m1/s1 |
| InChIKey | HNYCFKQIDGSCSH-DGXIYAMASA-M |
| XLogP | 2.20 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|