C23H20FNO5 — CID 1286299
4-[(2R)-2-(4-fluorophenyl)-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]butanoic acid (PubChem CID 1286299) has the molecular formula C23H20FNO5 and a molecular weight of 409.41 g/mol. Its IUPAC name is 4-[(2R)-2-(4-fluorophenyl)-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]butanoic acid.
| Compound Name | 4-[(2R)-2-(4-fluorophenyl)-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 1286299 |
| Molecular Formula | C23H20FNO5 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 4-[(2R)-2-(4-fluorophenyl)-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(O)=C(C(=O)/C=C/c2ccccc2)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H20FNO5/c24-17-11-9-16(10-12-17)21-20(18(26)13-8-15-5-2-1-3-6-15)22(29)23(30)25(21)14-4-7-19(27)28/h1-3,5-6,8-13,21,29H,4,7,14H2,(H,27,28)/b13-8+/t21-/m1/s1 |
| InChIKey | WAHDVZAPRVNXQO-CDDKBXLESA-N |
| XLogP | 3.67 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|