C25H23Cl2NO5 — CID 92849013
6-[(2S)-2-(2,4-dichlorophenyl)-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]hexanoic acid (PubChem CID 92849013) has the molecular formula C25H23Cl2NO5 and a molecular weight of 488.37 g/mol. Its IUPAC name is 6-[(2S)-2-(2,4-dichlorophenyl)-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]hexanoic acid.
| Compound Name | 6-[(2S)-2-(2,4-dichlorophenyl)-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 92849013 |
| Molecular Formula | C25H23Cl2NO5 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 6-[(2S)-2-(2,4-dichlorophenyl)-4-hydroxy-5-oxo-3-[(E)-3-phenylprop-2-enoyl]-2H-pyrrol-1-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C(O)=C(C(=O)/C=C/c2ccccc2)[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H23Cl2NO5/c26-17-11-12-18(19(27)15-17)23-22(20(29)13-10-16-7-3-1-4-8-16)24(32)25(33)28(23)14-6-2-5-9-21(30)31/h1,3-4,7-8,10-13,15,23,32H,2,5-6,9,14H2,(H,30,31)/b13-10+/t23-/m1/s1 |
| InChIKey | ZWMVFKYRRIGRFP-UQNNOOFXSA-N |
| XLogP | 5.62 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|