C23H22ClNO5 — CID 5052911
2-(2-chlorophenyl)-4-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 5052911) has the molecular formula C23H22ClNO5 and a molecular weight of 427.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 2-(2-chlorophenyl)-4-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 5052911 |
| Molecular Formula | C23H22ClNO5 |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-(2-chlorophenyl)-4-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | O=C(C=Cc1ccccc1)C1=C(O)C(=O)N(CCOCCO)C1c1ccccc1Cl |
| InChI | InChI=1S/C23H22ClNO5/c24-18-9-5-4-8-17(18)21-20(19(27)11-10-16-6-2-1-3-7-16)22(28)23(29)25(21)12-14-30-15-13-26/h1-11,21,26,28H,12-15H2 |
| InChIKey | BEMCMWJESLTDMF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|