C14H13BrN2O5 — CID 1423095
(2R)-3-acetyl-1-(2-bromoethyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 1423095) has the molecular formula C14H13BrN2O5 and a molecular weight of 369.17 g/mol. Its IUPAC name is (2R)-3-acetyl-1-(2-bromoethyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | (2R)-3-acetyl-1-(2-bromoethyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 1423095 |
| Molecular Formula | C14H13BrN2O5 |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | (2R)-3-acetyl-1-(2-bromoethyl)-4-hydroxy-2-(4-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | CC(=O)C1=C(O)C(=O)N(CCBr)[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H13BrN2O5/c1-8(18)11-12(16(7-6-15)14(20)13(11)19)9-2-4-10(5-3-9)17(21)22/h2-5,12,19H,6-7H2,1H3/t12-/m1/s1 |
| InChIKey | MKWWIDNVYLLTNN-GFCCVEGCSA-N |
| XLogP | 2.27 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|